Alkanes and alkenes are fundamental hydrocarbons in organic chemistry. Alkanes have single bonds, while alkenes contain at least one double bond, affecting their reactivity and applications.
What is the general formula for alkanes? a) CnH2n b) CnH2n+2 c) CnH2n-2 d) CnHn Answer: b) CnH2n+2
Which of the following is the simplest alkane? a) Methane b) Ethane c) Propane d) Butane Answer: a) Methane
What is the IUPAC name for a hydrocarbon with 5 carbon atoms? a) Pentane b) Hexane c) Heptane d) Octane Answer: a) Pentane
Which prefix is used for a cyclic alkane? a) Cyclo- b) Iso- c) Neo- d) Sec- Answer: a) Cyclo-
What is the parent chain in the following structure: CH3-CH2-CH(CH3)-CH2-CH3? a) Pentane b) Hexane c) Heptane d) Butane Answer: a) Pentane
Which of the following is an unsaturated hydrocarbon? a) Ethane b) Ethene c) Methane d) Propane Answer: b) Ethene
What is the IUPAC name for CH3-CH=CH2? a) Propene b) Butene c) Ethene d) Methane Answer: a) Propene
Which of the following is the correct IUPAC name for CH3-CH2-CH=CH2? a) 1-Butene b) 2-Butene c) 1-Pentene d) 2-Pentene Answer: a) 1-Butene
What is the name of the substituent -CH3? a) Methyl b) Ethyl c) Propyl d) Butyl Answer: a) Methyl
What is the name of the substituent -C2H5? a) Methyl b) Ethyl c) Propyl d) Butyl Answer: b) Ethyl
IUPAC Nomenclature
What is the parent chain in the following structure: CH3-CH2-CH(CH3)-CH2-CH3? a) Pentane b) Hexane c) Heptane d) Butane Answer: a) Pentane
What is the IUPAC name for CH3-CH2-CH(CH3)-CH2-CH3? a) 2-Methylpentane b) 3-Methylpentane c) 2-Methylbutane d) 3-Methylbutane Answer: b) 3-Methylpentane
What is the IUPAC name for CH3-CH(CH3)-CH2-CH3? a) 2-Methylbutane b) 3-Methylbutane c) 2-Methylpentane d) 3-Methylpentane Answer: a) 2-Methylbutane
What is the IUPAC name for CH3-CH2-CH2-CH(CH3)-CH3? a) 2-Methylpentane b) 3-Methylpentane c) 4-Methylpentane d) 2-Methylbutane Answer: b) 3-Methylpentane
What is the IUPAC name for CH3-CH2-CH(CH3)-CH2-CH2-CH3? a) 3-Methylhexane b) 2-Methylhexane c) 4-Methylhexane d) 3-Methylpentane Answer: a) 3-Methylhexane
What is the IUPAC name for CH3-CH2-CH2-CH2-CH(CH3)-CH3? a) 2-Methylhexane b) 3-Methylhexane c) 4-Methylhexane d) 5-Methylhexane Answer: b) 3-Methylhexane
What is the IUPAC name for CH3-CH2-CH(CH3)-CH2-CH2-CH2-CH3? a) 3-Methylheptane b) 2-Methylheptane c) 4-Methylheptane d) 5-Methylheptane Answer: a) 3-Methylheptane
What is the IUPAC name for CH3-CH2-CH2-CH(CH3)-CH2-CH2-CH3? a) 4-Methylheptane b) 3-Methylheptane c) 2-Methylheptane d) 5-Methylheptane Answer: a) 4-Methylheptane
What is the IUPAC name for CH3-CH2-CH2-CH2-CH(CH3)-CH2-CH3? a) 5-Methylheptane b) 4-Methylheptane c) 3-Methylheptane d) 2-Methylheptane Answer: a) 5-Methylheptane
What is the IUPAC name for CH3-CH2-CH2-CH2-CH2-CH(CH3)-CH3? a) 6-Methylheptane b) 5-Methylheptane c) 4-Methylheptane d) 3-Methylheptane Answer: a) 6-Methylheptane
Alkenes and Geometric Isomers
What is the general formula for alkenes? a) CnH2n b) CnH2n+2 c) CnH2n-2 d) CnHn Answer: a) CnH2n
Which of the following is the simplest alkene? a) Ethene b) Propene c) Butene d) Pentene Answer: a) Ethene
What is the IUPAC name for CH2=CH2? a) Ethene b) Propene c) Butene d) Pentene Answer: a) Ethene
What is the IUPAC name for CH3-CH=CH2? a) Propene b) Butene c) Pentene d) Hexene Answer: a) Propene
What is the IUPAC name for CH3-CH2-CH=CH2? a) 1-Butene b) 2-Butene c) 1-Pentene d) 2-Pentene Answer: a) 1-Butene
What is the IUPAC name for CH3-CH=CH-CH3? a) 2-Butene b) 1-Butene c) 2-Pentene d) 1-Pentene Answer: a) 2-Butene
What is the IUPAC name for CH3-CH2-CH=CH-CH3? a) 2-Pentene b) 1-Pentene c) 2-Hexene d) 1-Hexene Answer: a) 2-Pentene
What is the IUPAC name for CH3-CH2-CH2-CH=CH2? a) 1-Pentene b) 2-Pentene c) 1-Hexene d) 2-Hexene Answer: a) 1-Pentene
What is the IUPAC name for CH3-CH=CH-CH2-CH3? a) 2-Pentene b) 1-Pentene c) 2-Hexene d) 1-Hexene Answer: a) 2-Pentene
What is the IUPAC name for CH3-CH2-CH=CH-CH2-CH3? a) 2-Hexene b) 1-Hexene c) 2-Heptene d) 1-Heptene Answer: a) 2-Hexene
Geometric Isomers
What is the term for isomers that have the same connectivity but differ in spatial arrangement? a) Structural isomers b) Geometric isomers c) Conformational isomers d) Optical isomers Answer: b) Geometric isomers
Which of the following is a requirement for cis-trans isomerism in alkenes? a) Two identical groups on each carbon of the double bond b) Two different groups on each carbon of the double bond c) A single bond between the carbons d) A triple bond between the carbons Answer: b) Two different groups on each carbon of the double bond
What is the term for the isomer where the substituents are on the same side of the double bond? a) Cis b) Trans c) Syn d) Anti Answer: a) Cis
What is the term for the isomer where the substituents are on opposite sides of the double bond? a) Cis b) Trans c) Syn d) Anti Answer: b) Trans
Which of the following is an example of a cis isomer? a) Cis-2-butene b) Trans-2-butene c) Cis-1-butene d) Trans-1-butene Answer: a) Cis-2-butene
Which of the following is an example of a trans isomer? a) Cis-2-butene b) Trans-2-butene c) Cis-1-butene d) Trans-1-butene Answer: b) Trans-2-butene
What is the IUPAC name for the following compound: CH3-CH=CH-CH3 (cis)? a) Cis-2-butene b) Trans-2-butene c) Cis-1-butene d) Trans-1-butene Answer: a) Cis-2-butene
What is the IUPAC name for the following compound: CH3-CH=CH-CH3 (trans)? a) Cis-2-butene b) Trans-2-butene c) Cis-1-butene d) Trans-1-butene Answer: b) Trans-2-butene
What is the IUPAC name for the following compound: CH3-CH=CH-CH2-CH3 (cis)? a) Cis-2-pentene b) Trans-2-pentene c) Cis-1-pentene d) Trans-1-pentene Answer: a) Cis-2-pentene
What is the IUPAC name for the following compound: CH3-CH=CH-CH2-CH3 (trans)? a) Cis-2-pentene b) Trans-2-pentene c) Cis-1-pentene d) Trans-1-pentene Answer: b) Trans-2-pentene
Reactions of Alkanes
What is the product of the chlorination of methane? a) Chloromethane b) Dichloromethane c) Trichloromethane d) Tetrachloromethane Answer: a) Chloromethane
What is the product of the bromination of methane? a) Bromomethane b) Dibromomethane c) Tribromomethane d) Tetrabromomethane Answer: a) Bromomethane
What is the product of the chlorination of ethane? a) Chloroethane b) Dichloroethane c) Trichloroethane d) Tetrachloroethane Answer: a) Chloroethane
What is the product of the bromination of ethane? a) Bromoethane b) Dibromoethane c) Tribromoethane d) Tetrabromoethane Answer: a) Bromoethane
What is the product of the chlorination of propane? a) 1-Chloropropane b) 2-Chloropropane c) 1,2-Dichloropropane d) 1,3-Dichloropropane Answer: a) 1-Chloropropane
What is the product of the bromination of propane? a) 1-Bromopropane b) 2-Bromopropane c) 1,2-Dibromopropane d) 1,3-Dibromopropane Answer: a) 1-Bromopropane
What is the product of the chlorination of butane? a) 1-Chlorobutane b) 2-Chlorobutane c) 1,2-Dichlorobutane d) 1,3-Dichlorobutane Answer: a) 1-Chlorobutane
What is the product of the bromination of butane? a) 1-Bromobutane b) 2-Bromobutane c) 1,2-Dibromobutane d) 1,3-Dibromobutane Answer: a) 1-Bromobutane
What is the product of the chlorination of pentane? a) 1-Chloropentane b) 2-Chloropentane c) 1,2-Dichloropentane d) 1,3-Dichloropentane Answer: a) 1-Chloropentane
What is the product of the bromination of pentane? a) 1-Bromopentane b) 2-Bromopentane c) 1,2-Dibromopentane d) 1,3-Dibromopentane Answer: a) 1-Bromopentane
Reactions of Alkenes
What is the product of the hydrohalogenation of ethene with HCl? a) Chloroethane b) Dichloroethane c) Trichloroethane d) Tetrachloroethane Answer: a) Chloroethane
What is the product of the hydrohalogenation of propene with HBr? a) 1-Bromopropane b) 2-Bromopropane c) 1,2-Dibromopropane d) 1,3-Dibromopropane Answer: b) 2-Bromopropane
What is the product of the hydrohalogenation of butene with HI? a) 1-Iodobutane b) 2-Iodobutane c) 1,2-Diiodobutane d) 1,3-Diiodobutane Answer: b) 2-Iodobutane
What is the product of the hydrohalogenation of pentene with HCl? a) 1-Chloropentane b) 2-Chloropentane c) 1,2-Dichloropentane d) 1,3-Dichloropentane Answer: b) 2-Chloropentane
What is the product of the hydrohalogenation of hexene with HBr? a) 1-Bromohexane b) 2-Bromohexane c) 1,2-Dibromohexane d) 1,3-Dibromohexane Answer: b) 2-Bromohexane
What is the product of the hydrohalogenation of heptene with HI? a) 1-Iodoheptane b) 2-Iodoheptane c) 1,2-Diiodoheptane d) 1,3-Diiodoheptane Answer: b) 2-Iodoheptane
What is the product of the hydrohalogenation of octene with HCl? a) 1-Chlorooctane b) 2-Chlorooctane c) 1,2-Dichlorooctane d) 1,3-Dichlorooctane Answer: b) 2-Chlorooctane
What is the product of the hydrohalogenation of nonene with HBr? a) 1-Bromononane b) 2-Bromononane c) 1,2-Dibromononane d) 1,3-Dibromononane Answer: b) 2-Bromononane What is required for the initiation of the chlorination of methane? a) Heat or light b) A catalyst c) Pressure d) Water Answer: a) Heat or light What is the product of the chlorination of methane? a) Methanol b) Chloromethane c) Ethane d) Ethylene Answer: b) Chloromethane In the chlorination of methane, what is the first propagation step? a) Formation of a chlorine radical b) Formation of a methyl radical c) Formation of hydrogen chloride d) Formation of chloromethane Answer: b) Formation of a methyl radical What is the role of the chlorine radical in the chlorination of methane? a) It abstracts a hydrogen atom from methane b) It forms a bond with methane c) It acts as a catalyst d) It stabilizes the reaction Answer: a) It abstracts a hydrogen atom from methane What is the termination step in the chlorination of methane? a) Two radicals combine to form a stable molecule b) A radical reacts with a stable molecule c) A radical is formed d) A catalyst is regenerated Answer: a) Two radicals combine to form a stable molecule Which of the following is a free radical? a) Methane b) Chlorine atom c) Chloromethane d) Hydrogen chloride Answer: b) Chlorine atom What is the intermediate formed during the propagation step of the chlorination of methane? a) Methyl radical b) Ethyl radical c) Chlorine molecule d) Hydrogen chloride Answer: a) Methyl radical What is the final product of the chlorination of methane? a) Chloromethane b) Dichloromethane c) Trichloromethane d) Tetrachloromethane Answer: a) Chloromethane
Reaction of Alkenes What is the product of hydrohalogenation of an alkene? a) Alkane b) Alcohol c) Alkyl halide d) Ether Answer: c) Alkyl halide What is the regioselectivity of hydrohalogenation in the absence of peroxides? a) Markovnikov b) Anti-Markovnikov c) Syn addition d) Anti addition Answer: a) Markovnikov What is the regioselectivity of hydrohalogenation in the presence of peroxides? a) Markovnikov b) Anti-Markovnikov c) Syn addition d) Anti addition Answer: b) Anti-Markovnikov What is the major product of the hydrohalogenation of propene with HBr? a) 1-bromopropane b) 2-bromopropane c) 1,2-dibromopropane d) Propane Answer: b) 2-bromopropane What is the mechanism of hydrohalogenation? a) Nucleophilic attack followed by proton transfer b) Proton transfer followed by nucleophilic attack c) Radical formation followed by termination d) Elimination followed by addition Answer: b) Proton transfer followed by nucleophilic attack What is the stereochemistry of hydrohalogenation? a) Syn addition b) Anti addition c) Racemic mixture d) No stereochemistry Answer: c) Racemic mixture What is the product of acid-catalyzed hydration of an alkene? a) Alkane b) Alcohol c) Alkyl halide d) Ether Answer: b) Alcohol What is the regioselectivity of acid-catalyzed hydration? a) Markovnikov b) Anti-Markovnikov c) Syn addition d) Anti addition Answer: a) Markovnikov What is the mechanism of acid-catalyzed hydration? a) Proton transfer followed by nucleophilic attack b) Nucleophilic attack followed by proton transfer c) Radical formation followed by termination d) Elimination followed by addition Answer: a) Proton transfer followed by nucleophilic attack What is the product of oxymercuration-demercuration of an alkene? a) Alkane b) Alcohol c) Alkyl halide d) Ether Answer: b) Alcohol What is the regioselectivity of oxymercuration-demercuration? a) Markovnikov b) Anti-Markovnikov c) Syn addition d) Anti addition Answer: a) Markovnikov What is the advantage of oxymercuration-demercuration over acid-catalyzed hydration? a) No rearrangements occur b) Faster reaction c) Higher yield d) No catalyst required Answer: a) No rearrangements occur What is the product of hydroboration-oxidation of an alkene? a) Alkane b) Alcohol c) Alkyl halide d) Ether Answer: b) Alcohol What is the regioselectivity of hydroboration-oxidation? a) Markovnikov b) Anti-Markovnikov c) Syn addition d) Anti addition Answer: b) Anti-Markovnikov What is the stereochemistry of hydroboration-oxidation? a) Syn addition b) Anti addition c) Racemic mixture d) No stereochemistry Answer: a) Syn addition What is the product of catalytic hydrogenation of an alkene? a) Alkane b) Alcohol c) Alkyl halide d) Ether Answer: a) Alkane What is the stereochemistry of catalytic hydrogenation? a) Syn addition b) Anti addition c) Racemic mixture d) No stereochemistry Answer: a) Syn addition What is the product of halogenation of an alkene? a) Alkane b) Alcohol c) Alkyl halide d) Vicinal dihalide Answer: d) Vicinal dihalide What is the stereochemistry of halogenation? a) Syn addition b) Anti addition c) Racemic mixture d) No stereochemistry Answer: b) Anti addition What is the intermediate formed during halogenation of an alkene? a) Carbocation b) Bromonium ion c) Radical d) Carbanion Answer: b) Bromonium ion What is the product of halohydrin formation? a) Alkane b) Alcohol c) Halohydrin d) Ether Answer: c) Halohydrin What is the regioselectivity of halohydrin formation? a) Halogen adds to the more substituted carbon b) Halogen adds to the less substituted carbon c) OH adds to the more substituted carbon d) OH adds to the less substituted carbon Answer: b) Halogen adds to the less substituted carbon What is the product of anti-dihydroxylation of an alkene? a) Alkane b) Alcohol c) Vicinal diol d) Ether Answer: c) Vicinal diol What is the stereochemistry of anti-dihydroxylation? a) Syn addition b) Anti addition c) Racemic mixture d) No stereochemistry Answer: b) Anti addition What is the product of syn-dihydroxylation of an alkene? a) Alkane b) Alcohol c) Vicinal diol d) Ether Answer: c) Vicinal diol What is the stereochemistry of syn-dihydroxylation? a) Syn addition b) Anti addition c) Racemic mixture d) No stereochemistry Answer: a) Syn addition What is the product of ozonolysis of an alkene? a) Alkane b) Alcohol c) Aldehyde or ketone d) Ether Answer: c) Aldehyde or ketone What is the intermediate formed during ozonolysis? a) Ozonide b) Carbocation c) Radical d) Carbanion Answer: a) Ozonide What is the product of hydrohalogenation of 2-methylpropene with HBr? a) 1-bromo-2-methylpropane b) 2-bromo-2-methylpropane c) 1,2-dibromo-2-methylpropane d) 2-methylpropane Answer: b) 2-bromo-2-methylpropane What is the product of hydroboration-oxidation of 1-methylcyclopentene? a) 1-methylcyclopentanol b) 2-methylcyclopentanol c) 1,2-dihydroxycyclopentane d) Cyclopentane Answer: b) 2-methylcyclopentanol What is the product of catalytic hydrogenation of 2-butene? a) Butane b) 2-butanol c) 2-bromobutane d) 1-butene Answer: a) Butane What is the product of halogenation of cyclohexene with Br2? a) 1,2-dibromocyclohexane b) Bromocyclohexane c) Cyclohexane d) 1-bromocyclohexane Answer: a) 1,2-dibromocyclohexane What is the product of halohydrin formation of 1-methylcyclohexene with Br2 and H2O? a) 1-bromo-2-methylcyclohexanol b) 2-bromo-1-methylcyclohexanol c) 1,2-dibromo-1-methylcyclohexane d) 1-methylcyclohexane Answer: b) 2-bromo-1-methylcyclohexanol What is the product of anti-dihydroxylation of 1-methylcyclohexene? a) 1,2-dihydroxy-1-methylcyclohexane b) 1-methylcyclohexanol c) 1-methylcyclohexane d) 1,2-dibromo-1-methylcyclohexane Answer: a) 1,2-dihydroxy-1-methylcyclohexane What is the product of syn-dihydroxylation of 1-methylcyclohexene? a) 1,2-dihydroxy-1-methylcyclohexane b) 1-methylcyclohexanol c) 1-methylcyclohexane d) 1,2-dibromo-1-methylcyclohexane Answer: a) 1,2-dihydroxy-1-methylcyclohexane What is the product of ozonolysis of 2-methyl-2-butene? a) Acetone and formaldehyde b) Acetaldehyde and formaldehyde c) Acetone and acetaldehyde d) Formaldehyde and acetaldehyde Answer: a) Acetone and formaldehyde What is the product of hydrohalogenation of 1-butene with HBr in the presence of peroxides? a) 1-bromobutane b) 2-bromobutane c) 1,2-dibromobutane d) Butane Answer: a) 1-bromobutane