Alkanes and Alkenes Mcqs

Alkanes and alkenes are fundamental hydrocarbons in organic chemistry. Alkanes have single bonds, while alkenes contain at least one double bond, affecting their reactivity and applications.

What is the general formula for alkanes?
a) CnH2n
b) CnH2n+2
c) CnH2n-2
d) CnHn
Answer: b) CnH2n+2
Which of the following is the simplest alkane?
a) Methane
b) Ethane
c) Propane
d) Butane
Answer: a) Methane
What is the IUPAC name for a hydrocarbon with 5 carbon atoms?
a) Pentane
b) Hexane
c) Heptane
d) Octane
Answer: a) Pentane
Which prefix is used for a cyclic alkane?
a) Cyclo-
b) Iso-
c) Neo-
d) Sec-
Answer: a) Cyclo-
What is the parent chain in the following structure: CH3-CH2-CH(CH3)-CH2-CH3?
a) Pentane
b) Hexane
c) Heptane
d) Butane
Answer: a) Pentane
Which of the following is an unsaturated hydrocarbon?
a) Ethane
b) Ethene
c) Methane
d) Propane
Answer: b) Ethene
What is the IUPAC name for CH3-CH=CH2?
a) Propene
b) Butene
c) Ethene
d) Methane
Answer: a) Propene
Which of the following is the correct IUPAC name for CH3-CH2-CH=CH2?
a) 1-Butene
b) 2-Butene
c) 1-Pentene
d) 2-Pentene
Answer: a) 1-Butene
What is the name of the substituent -CH3?
a) Methyl
b) Ethyl
c) Propyl
d) Butyl
Answer: a) Methyl
What is the name of the substituent -C2H5?
a) Methyl
b) Ethyl
c) Propyl
d) Butyl
Answer: b) Ethyl

IUPAC Nomenclature

What is the parent chain in the following structure: CH3-CH2-CH(CH3)-CH2-CH3?
a) Pentane
b) Hexane
c) Heptane
d) Butane
Answer: a) Pentane
What is the IUPAC name for CH3-CH2-CH(CH3)-CH2-CH3?
a) 2-Methylpentane
b) 3-Methylpentane
c) 2-Methylbutane
d) 3-Methylbutane
Answer: b) 3-Methylpentane
What is the IUPAC name for CH3-CH(CH3)-CH2-CH3?
a) 2-Methylbutane
b) 3-Methylbutane
c) 2-Methylpentane
d) 3-Methylpentane
Answer: a) 2-Methylbutane
What is the IUPAC name for CH3-CH2-CH2-CH(CH3)-CH3?
a) 2-Methylpentane
b) 3-Methylpentane
c) 4-Methylpentane
d) 2-Methylbutane
Answer: b) 3-Methylpentane
What is the IUPAC name for CH3-CH2-CH(CH3)-CH2-CH2-CH3?
a) 3-Methylhexane
b) 2-Methylhexane
c) 4-Methylhexane
d) 3-Methylpentane
Answer: a) 3-Methylhexane
What is the IUPAC name for CH3-CH2-CH2-CH2-CH(CH3)-CH3?
a) 2-Methylhexane
b) 3-Methylhexane
c) 4-Methylhexane
d) 5-Methylhexane
Answer: b) 3-Methylhexane
What is the IUPAC name for CH3-CH2-CH(CH3)-CH2-CH2-CH2-CH3?
a) 3-Methylheptane
b) 2-Methylheptane
c) 4-Methylheptane
d) 5-Methylheptane
Answer: a) 3-Methylheptane
What is the IUPAC name for CH3-CH2-CH2-CH(CH3)-CH2-CH2-CH3?
a) 4-Methylheptane
b) 3-Methylheptane
c) 2-Methylheptane
d) 5-Methylheptane
Answer: a) 4-Methylheptane
What is the IUPAC name for CH3-CH2-CH2-CH2-CH(CH3)-CH2-CH3?
a) 5-Methylheptane
b) 4-Methylheptane
c) 3-Methylheptane
d) 2-Methylheptane
Answer: a) 5-Methylheptane
What is the IUPAC name for CH3-CH2-CH2-CH2-CH2-CH(CH3)-CH3?
a) 6-Methylheptane
b) 5-Methylheptane
c) 4-Methylheptane
d) 3-Methylheptane
Answer: a) 6-Methylheptane

Alkenes and Geometric Isomers

What is the general formula for alkenes?
a) CnH2n
b) CnH2n+2
c) CnH2n-2
d) CnHn
Answer: a) CnH2n
Which of the following is the simplest alkene?
a) Ethene
b) Propene
c) Butene
d) Pentene
Answer: a) Ethene
What is the IUPAC name for CH2=CH2?
a) Ethene
b) Propene
c) Butene
d) Pentene
Answer: a) Ethene
What is the IUPAC name for CH3-CH=CH2?
a) Propene
b) Butene
c) Pentene
d) Hexene
Answer: a) Propene
What is the IUPAC name for CH3-CH2-CH=CH2?
a) 1-Butene
b) 2-Butene
c) 1-Pentene
d) 2-Pentene
Answer: a) 1-Butene
What is the IUPAC name for CH3-CH=CH-CH3?
a) 2-Butene
b) 1-Butene
c) 2-Pentene
d) 1-Pentene
Answer: a) 2-Butene
What is the IUPAC name for CH3-CH2-CH=CH-CH3?
a) 2-Pentene
b) 1-Pentene
c) 2-Hexene
d) 1-Hexene
Answer: a) 2-Pentene
What is the IUPAC name for CH3-CH2-CH2-CH=CH2?
a) 1-Pentene
b) 2-Pentene
c) 1-Hexene
d) 2-Hexene
Answer: a) 1-Pentene
What is the IUPAC name for CH3-CH=CH-CH2-CH3?
a) 2-Pentene
b) 1-Pentene
c) 2-Hexene
d) 1-Hexene
Answer: a) 2-Pentene
What is the IUPAC name for CH3-CH2-CH=CH-CH2-CH3?
a) 2-Hexene
b) 1-Hexene
c) 2-Heptene
d) 1-Heptene
Answer: a) 2-Hexene

Geometric Isomers

What is the term for isomers that have the same connectivity but differ in spatial arrangement?
a) Structural isomers
b) Geometric isomers
c) Conformational isomers
d) Optical isomers
Answer: b) Geometric isomers
Which of the following is a requirement for cis-trans isomerism in alkenes?
a) Two identical groups on each carbon of the double bond
b) Two different groups on each carbon of the double bond
c) A single bond between the carbons
d) A triple bond between the carbons
Answer: b) Two different groups on each carbon of the double bond
What is the term for the isomer where the substituents are on the same side of the double bond?
a) Cis
b) Trans
c) Syn
d) Anti
Answer: a) Cis
What is the term for the isomer where the substituents are on opposite sides of the double bond?
a) Cis
b) Trans
c) Syn
d) Anti
Answer: b) Trans
Which of the following is an example of a cis isomer?
a) Cis-2-butene
b) Trans-2-butene
c) Cis-1-butene
d) Trans-1-butene
Answer: a) Cis-2-butene
Which of the following is an example of a trans isomer?
a) Cis-2-butene
b) Trans-2-butene
c) Cis-1-butene
d) Trans-1-butene
Answer: b) Trans-2-butene
What is the IUPAC name for the following compound: CH3-CH=CH-CH3 (cis)?
a) Cis-2-butene
b) Trans-2-butene
c) Cis-1-butene
d) Trans-1-butene
Answer: a) Cis-2-butene
What is the IUPAC name for the following compound: CH3-CH=CH-CH3 (trans)?
a) Cis-2-butene
b) Trans-2-butene
c) Cis-1-butene
d) Trans-1-butene
Answer: b) Trans-2-butene
What is the IUPAC name for the following compound: CH3-CH=CH-CH2-CH3 (cis)?
a) Cis-2-pentene
b) Trans-2-pentene
c) Cis-1-pentene
d) Trans-1-pentene
Answer: a) Cis-2-pentene
What is the IUPAC name for the following compound: CH3-CH=CH-CH2-CH3 (trans)?
a) Cis-2-pentene
b) Trans-2-pentene
c) Cis-1-pentene
d) Trans-1-pentene
Answer: b) Trans-2-pentene

Reactions of Alkanes

What is the product of the chlorination of methane?
a) Chloromethane
b) Dichloromethane
c) Trichloromethane
d) Tetrachloromethane
Answer: a) Chloromethane
What is the product of the bromination of methane?
a) Bromomethane
b) Dibromomethane
c) Tribromomethane
d) Tetrabromomethane
Answer: a) Bromomethane
What is the product of the chlorination of ethane?
a) Chloroethane
b) Dichloroethane
c) Trichloroethane
d) Tetrachloroethane
Answer: a) Chloroethane
What is the product of the bromination of ethane?
a) Bromoethane
b) Dibromoethane
c) Tribromoethane
d) Tetrabromoethane
Answer: a) Bromoethane
What is the product of the chlorination of propane?
a) 1-Chloropropane
b) 2-Chloropropane
c) 1,2-Dichloropropane
d) 1,3-Dichloropropane
Answer: a) 1-Chloropropane
What is the product of the bromination of propane?
a) 1-Bromopropane
b) 2-Bromopropane
c) 1,2-Dibromopropane
d) 1,3-Dibromopropane
Answer: a) 1-Bromopropane
What is the product of the chlorination of butane?
a) 1-Chlorobutane
b) 2-Chlorobutane
c) 1,2-Dichlorobutane
d) 1,3-Dichlorobutane
Answer: a) 1-Chlorobutane
What is the product of the bromination of butane?
a) 1-Bromobutane
b) 2-Bromobutane
c) 1,2-Dibromobutane
d) 1,3-Dibromobutane
Answer: a) 1-Bromobutane
What is the product of the chlorination of pentane?
a) 1-Chloropentane
b) 2-Chloropentane
c) 1,2-Dichloropentane
d) 1,3-Dichloropentane
Answer: a) 1-Chloropentane
What is the product of the bromination of pentane?
a) 1-Bromopentane
b) 2-Bromopentane
c) 1,2-Dibromopentane
d) 1,3-Dibromopentane
Answer: a) 1-Bromopentane

Reactions of Alkenes

What is the product of the hydrohalogenation of ethene with HCl?
a) Chloroethane
b) Dichloroethane
c) Trichloroethane
d) Tetrachloroethane
Answer: a) Chloroethane
What is the product of the hydrohalogenation of propene with HBr?
a) 1-Bromopropane
b) 2-Bromopropane
c) 1,2-Dibromopropane
d) 1,3-Dibromopropane
Answer: b) 2-Bromopropane
What is the product of the hydrohalogenation of butene with HI?
a) 1-Iodobutane
b) 2-Iodobutane
c) 1,2-Diiodobutane
d) 1,3-Diiodobutane
Answer: b) 2-Iodobutane
What is the product of the hydrohalogenation of pentene with HCl?
a) 1-Chloropentane
b) 2-Chloropentane
c) 1,2-Dichloropentane
d) 1,3-Dichloropentane
Answer: b) 2-Chloropentane
What is the product of the hydrohalogenation of hexene with HBr?
a) 1-Bromohexane
b) 2-Bromohexane
c) 1,2-Dibromohexane
d) 1,3-Dibromohexane
Answer: b) 2-Bromohexane
What is the product of the hydrohalogenation of heptene with HI?
a) 1-Iodoheptane
b) 2-Iodoheptane
c) 1,2-Diiodoheptane
d) 1,3-Diiodoheptane
Answer: b) 2-Iodoheptane
What is the product of the hydrohalogenation of octene with HCl?
a) 1-Chlorooctane
b) 2-Chlorooctane
c) 1,2-Dichlorooctane
d) 1,3-Dichlorooctane
Answer: b) 2-Chlorooctane
What is the product of the hydrohalogenation of nonene with HBr?
a) 1-Bromononane
b) 2-Bromononane
c) 1,2-Dibromononane
d) 1,3-Dibromononane
Answer: b) 2-Bromononane
What is required for the initiation of the chlorination of methane?
a) Heat or light
b) A catalyst
c) Pressure
d) Water
Answer: a) Heat or light
What is the product of the chlorination of methane?
a) Methanol
b) Chloromethane
c) Ethane
d) Ethylene
Answer: b) Chloromethane
In the chlorination of methane, what is the first propagation step?
a) Formation of a chlorine radical
b) Formation of a methyl radical
c) Formation of hydrogen chloride
d) Formation of chloromethane
Answer: b) Formation of a methyl radical
What is the role of the chlorine radical in the chlorination of methane?
a) It abstracts a hydrogen atom from methane
b) It forms a bond with methane
c) It acts as a catalyst
d) It stabilizes the reaction
Answer: a) It abstracts a hydrogen atom from methane
What is the termination step in the chlorination of methane?
a) Two radicals combine to form a stable molecule
b) A radical reacts with a stable molecule
c) A radical is formed
d) A catalyst is regenerated
Answer: a) Two radicals combine to form a stable molecule
Which of the following is a free radical?
a) Methane
b) Chlorine atom
c) Chloromethane
d) Hydrogen chloride
Answer: b) Chlorine atom
What is the intermediate formed during the propagation step of the chlorination of methane?
a) Methyl radical
b) Ethyl radical
c) Chlorine molecule
d) Hydrogen chloride
Answer: a) Methyl radical
What is the final product of the chlorination of methane?
a) Chloromethane
b) Dichloromethane
c) Trichloromethane
d) Tetrachloromethane
Answer: a) Chloromethane

Reaction of Alkenes
What is the product of hydrohalogenation of an alkene?
a) Alkane
b) Alcohol
c) Alkyl halide
d) Ether
Answer: c) Alkyl halide
What is the regioselectivity of hydrohalogenation in the absence of peroxides?
a) Markovnikov
b) Anti-Markovnikov
c) Syn addition
d) Anti addition
Answer: a) Markovnikov
What is the regioselectivity of hydrohalogenation in the presence of peroxides?
a) Markovnikov
b) Anti-Markovnikov
c) Syn addition
d) Anti addition
Answer: b) Anti-Markovnikov
What is the major product of the hydrohalogenation of propene with HBr?
a) 1-bromopropane
b) 2-bromopropane
c) 1,2-dibromopropane
d) Propane
Answer: b) 2-bromopropane
What is the mechanism of hydrohalogenation?
a) Nucleophilic attack followed by proton transfer
b) Proton transfer followed by nucleophilic attack
c) Radical formation followed by termination
d) Elimination followed by addition
Answer: b) Proton transfer followed by nucleophilic attack
What is the stereochemistry of hydrohalogenation?
a) Syn addition
b) Anti addition
c) Racemic mixture
d) No stereochemistry
Answer: c) Racemic mixture
What is the product of acid-catalyzed hydration of an alkene?
a) Alkane
b) Alcohol
c) Alkyl halide
d) Ether
Answer: b) Alcohol
What is the regioselectivity of acid-catalyzed hydration?
a) Markovnikov
b) Anti-Markovnikov
c) Syn addition
d) Anti addition
Answer: a) Markovnikov
What is the mechanism of acid-catalyzed hydration?
a) Proton transfer followed by nucleophilic attack
b) Nucleophilic attack followed by proton transfer
c) Radical formation followed by termination
d) Elimination followed by addition
Answer: a) Proton transfer followed by nucleophilic attack
What is the product of oxymercuration-demercuration of an alkene?
a) Alkane
b) Alcohol
c) Alkyl halide
d) Ether
Answer: b) Alcohol
What is the regioselectivity of oxymercuration-demercuration?
a) Markovnikov
b) Anti-Markovnikov
c) Syn addition
d) Anti addition
Answer: a) Markovnikov
What is the advantage of oxymercuration-demercuration over acid-catalyzed hydration?
a) No rearrangements occur
b) Faster reaction
c) Higher yield
d) No catalyst required
Answer: a) No rearrangements occur
What is the product of hydroboration-oxidation of an alkene?
a) Alkane
b) Alcohol
c) Alkyl halide
d) Ether
Answer: b) Alcohol
What is the regioselectivity of hydroboration-oxidation?
a) Markovnikov
b) Anti-Markovnikov
c) Syn addition
d) Anti addition
Answer: b) Anti-Markovnikov
What is the stereochemistry of hydroboration-oxidation?
a) Syn addition
b) Anti addition
c) Racemic mixture
d) No stereochemistry
Answer: a) Syn addition
What is the product of catalytic hydrogenation of an alkene?
a) Alkane
b) Alcohol
c) Alkyl halide
d) Ether
Answer: a) Alkane
What is the stereochemistry of catalytic hydrogenation?
a) Syn addition
b) Anti addition
c) Racemic mixture
d) No stereochemistry
Answer: a) Syn addition
What is the product of halogenation of an alkene?
a) Alkane
b) Alcohol
c) Alkyl halide
d) Vicinal dihalide
Answer: d) Vicinal dihalide
What is the stereochemistry of halogenation?
a) Syn addition
b) Anti addition
c) Racemic mixture
d) No stereochemistry
Answer: b) Anti addition
What is the intermediate formed during halogenation of an alkene?
a) Carbocation
b) Bromonium ion
c) Radical
d) Carbanion
Answer: b) Bromonium ion
What is the product of halohydrin formation?
a) Alkane
b) Alcohol
c) Halohydrin
d) Ether
Answer: c) Halohydrin
What is the regioselectivity of halohydrin formation?
a) Halogen adds to the more substituted carbon
b) Halogen adds to the less substituted carbon
c) OH adds to the more substituted carbon
d) OH adds to the less substituted carbon
Answer: b) Halogen adds to the less substituted carbon
What is the product of anti-dihydroxylation of an alkene?
a) Alkane
b) Alcohol
c) Vicinal diol
d) Ether
Answer: c) Vicinal diol
What is the stereochemistry of anti-dihydroxylation?
a) Syn addition
b) Anti addition
c) Racemic mixture
d) No stereochemistry
Answer: b) Anti addition
What is the product of syn-dihydroxylation of an alkene?
a) Alkane
b) Alcohol
c) Vicinal diol
d) Ether
Answer: c) Vicinal diol
What is the stereochemistry of syn-dihydroxylation?
a) Syn addition
b) Anti addition
c) Racemic mixture
d) No stereochemistry
Answer: a) Syn addition
What is the product of ozonolysis of an alkene?
a) Alkane
b) Alcohol
c) Aldehyde or ketone
d) Ether
Answer: c) Aldehyde or ketone
What is the intermediate formed during ozonolysis?
a) Ozonide
b) Carbocation
c) Radical
d) Carbanion
Answer: a) Ozonide
What is the product of hydrohalogenation of 2-methylpropene with HBr?
a) 1-bromo-2-methylpropane
b) 2-bromo-2-methylpropane
c) 1,2-dibromo-2-methylpropane
d) 2-methylpropane
Answer: b) 2-bromo-2-methylpropane
What is the product of hydroboration-oxidation of 1-methylcyclopentene?
a) 1-methylcyclopentanol
b) 2-methylcyclopentanol
c) 1,2-dihydroxycyclopentane
d) Cyclopentane
Answer: b) 2-methylcyclopentanol
What is the product of catalytic hydrogenation of 2-butene?
a) Butane
b) 2-butanol
c) 2-bromobutane
d) 1-butene
Answer: a) Butane
What is the product of halogenation of cyclohexene with Br2?
a) 1,2-dibromocyclohexane
b) Bromocyclohexane
c) Cyclohexane
d) 1-bromocyclohexane
Answer: a) 1,2-dibromocyclohexane
What is the product of halohydrin formation of 1-methylcyclohexene with Br2 and H2O?
a) 1-bromo-2-methylcyclohexanol
b) 2-bromo-1-methylcyclohexanol
c) 1,2-dibromo-1-methylcyclohexane
d) 1-methylcyclohexane
Answer: b) 2-bromo-1-methylcyclohexanol
What is the product of anti-dihydroxylation of 1-methylcyclohexene?
a) 1,2-dihydroxy-1-methylcyclohexane
b) 1-methylcyclohexanol
c) 1-methylcyclohexane
d) 1,2-dibromo-1-methylcyclohexane
Answer: a) 1,2-dihydroxy-1-methylcyclohexane
What is the product of syn-dihydroxylation of 1-methylcyclohexene?
a) 1,2-dihydroxy-1-methylcyclohexane
b) 1-methylcyclohexanol
c) 1-methylcyclohexane
d) 1,2-dibromo-1-methylcyclohexane
Answer: a) 1,2-dihydroxy-1-methylcyclohexane
What is the product of ozonolysis of 2-methyl-2-butene?
a) Acetone and formaldehyde
b) Acetaldehyde and formaldehyde
c) Acetone and acetaldehyde
d) Formaldehyde and acetaldehyde
Answer: a) Acetone and formaldehyde
What is the product of hydrohalogenation of 1-butene with HBr in the presence of peroxides?
a) 1-bromobutane
b) 2-bromobutane
c) 1,2-dibromobutane
d) Butane
Answer: a) 1-bromobutane